C10H19BN3O13P3 — CID 11294879
CID 11294879 (PubChem CID 11294879) has the molecular formula C10H19BN3O13P3 and a molecular weight of 493.00 g/mol.
| Compound Name | CID 11294879 |
|---|---|
| PubChem CID | 11294879 |
| Molecular Formula | C10H19BN3O13P3 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | — |
| SMILES | N.[B]P(=O)(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H16BN2O13P3.H3N/c1-5-3-13(10(16)12-9(5)15)8-2-6(14)7(24-8)4-23-27(11,17)25-29(21,22)26-28(18,19)20;/h3,6-8,14H,2,4H2,1H3,(H,21,22)(H,12,15,16)(H2,18,19,20);1H3/t6-,7+,8+,27?;/m0./s1 |
| InChIKey | OYPVFBNGKJHUTR-VRUBIFJDSA-N |
| XLogP | -0.83 |
| TPSA | 258.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|