C10H18BN3O10P2 — CID 11223745
CID 11223745 (PubChem CID 11223745) has the molecular formula C10H18BN3O10P2 and a molecular weight of 413.03 g/mol.
| Compound Name | CID 11223745 |
|---|---|
| PubChem CID | 11223745 |
| Molecular Formula | C10H18BN3O10P2 |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | — |
| SMILES | N.[B]P(=O)(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O)OP(=O)(O)O |
| InChI | InChI=1S/C10H15BN2O10P2.H3N/c1-5-3-13(10(16)12-9(5)15)8-2-6(14)7(22-8)4-21-24(11,17)23-25(18,19)20;/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)(H2,18,19,20);1H3/t6-,7+,8+,24?;/m0./s1 |
| InChIKey | MKGMRQVDDFFKEP-KPTXEBRASA-N |
| XLogP | -0.94 |
| TPSA | 212.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|