C10H12FN2O5P — CID 118327336
1-[(2R,3R,5S)-3-fluoro-3-methyl-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 118327336) has the molecular formula C10H12FN2O5P and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-3-fluoro-3-methyl-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5S)-3-fluoro-3-methyl-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118327336 |
| Molecular Formula | C10H12FN2O5P |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-[(2R,3R,5S)-3-fluoro-3-methyl-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]1(F)C[C@@H](COP=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12FN2O5P/c1-10(11)4-6(5-17-19-16)18-8(10)13-3-2-7(14)12-9(13)15/h2-3,6,8H,4-5H2,1H3,(H,12,14,15)/t6-,8+,10+/m0/s1 |
| InChIKey | ZSZGEPQIHLCJAD-SKWCMTHISA-N |
| XLogP | 0.78 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|