C11H15ClN2O4 — CID 123500574
1-[3-chloro-5-(methoxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 123500574) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-[3-chloro-5-(methoxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-chloro-5-(methoxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123500574 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-[3-chloro-5-(methoxymethyl)-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COCC1CC(C)(Cl)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C11H15ClN2O4/c1-11(12)5-7(6-17-2)18-9(11)14-4-3-8(15)13-10(14)16/h3-4,7,9H,5-6H2,1-2H3,(H,13,15,16) |
| InChIKey | NXKGTCSMHCRCEN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|