C9H9ClFN2O6P — CID 134243545
1-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 134243545) has the molecular formula C9H9ClFN2O6P and a molecular weight of 326.60 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134243545 |
| Molecular Formula | C9H9ClFN2O6P |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3-chloro-3-fluoro-4-hydroxy-5-(phosphorosooxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=POC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](F)(Cl)[C@@H]1O |
| InChI | InChI=1S/C9H9ClFN2O6P/c10-9(11)6(15)4(3-18-20-17)19-7(9)13-2-1-5(14)12-8(13)16/h1-2,4,6-7,15H,3H2,(H,12,14,16)/t4-,6-,7-,9-/m1/s1 |
| InChIKey | GIJRIAWTXXBITK-FJGDRVTGSA-N |
| XLogP | -0.08 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|