C24H37N4O8P — CID 145155283
methyl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]-3-methylbutanoate;propane-2,2-diol (PubChem CID 145155283) has the molecular formula C24H37N4O8P and a molecular weight of 540.55 g/mol. Its IUPAC name is methyl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]-3-methylbutanoate;propane-2,2-diol.
| Compound Name | methyl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]-3-methylbutanoate;propane-2,2-diol |
|---|---|
| PubChem CID | 145155283 |
| Molecular Formula | C24H37N4O8P |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | methyl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]-3-methylbutanoate;propane-2,2-diol |
| SMILES | CC(C)(O)O.COC(=O)C(NP(OCC1CCC(n2ccc(N)nc2=O)O1)Oc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H29N4O6P.C3H8O2/c1-14(2)19(20(26)28-3)24-32(31-15-7-5-4-6-8-15)29-13-16-9-10-18(30-16)25-12-11-17(22)23-21(25)27;1-3(2,4)5/h4-8,11-12,14,16,18-19,24H,9-10,13H2,1-3H3,(H2,22,23,27);4-5H,1-2H3 |
| InChIKey | FXXNKEGWQGPHSN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|