C15H17N3O3 — CID 70382786
4-amino-1-[(2R,5S)-5-(phenoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 70382786) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-5-(phenoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5S)-5-(phenoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 70382786 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-amino-1-[(2R,5S)-5-(phenoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2CC[C@@H](COc3ccccc3)O2)c(=O)n1 |
| InChI | InChI=1S/C15H17N3O3/c16-13-8-9-18(15(19)17-13)14-7-6-12(21-14)10-20-11-4-2-1-3-5-11/h1-5,8-9,12,14H,6-7,10H2,(H2,16,17,19)/t12-,14+/m0/s1 |
| InChIKey | UYYGWTMBUUWMCK-GXTWGEPZSA-N |
| XLogP | 1.58 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |