C9H12N4O3 — CID 142117937
4-amino-1-[5-(nitrosomethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 142117937) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-amino-1-[5-(nitrosomethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-(nitrosomethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 142117937 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-amino-1-[5-(nitrosomethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2CCC(CN=O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H12N4O3/c10-7-3-4-13(9(14)12-7)8-2-1-6(16-8)5-11-15/h3-4,6,8H,1-2,5H2,(H2,10,12,14) |
| InChIKey | OSXQEVDHRIJAKE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |