C20H26FN4O6P — CID 144900507
propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate (PubChem CID 144900507) has the molecular formula C20H26FN4O6P and a molecular weight of 468.42 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 144900507 |
| Molecular Formula | C20H26FN4O6P |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNP(OCC1OC(n2ccc(N)nc2=O)CC1F)Oc1ccccc1 |
| InChI | InChI=1S/C20H26FN4O6P/c1-13(2)29-19(26)11-23-32(31-14-6-4-3-5-7-14)28-12-16-15(21)10-18(30-16)25-9-8-17(22)24-20(25)27/h3-9,13,15-16,18,23H,10-12H2,1-2H3,(H2,22,24,27) |
| InChIKey | KPTAXBKRDSFZGY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|