C22H30N3O6P — CID 142505333
propan-2-yl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate (PubChem CID 142505333) has the molecular formula C22H30N3O6P and a molecular weight of 463.47 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate |
|---|---|
| PubChem CID | 142505333 |
| Molecular Formula | C22H30N3O6P |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | propan-2-yl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNP(OCC1CCC(N2C=CCC(C(N)=O)=C2)O1)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N3O6P/c1-16(2)29-21(26)13-24-32(31-18-8-4-3-5-9-18)28-15-19-10-11-20(30-19)25-12-6-7-17(14-25)22(23)27/h3-6,8-9,12,14,16,19-20,24H,7,10-11,13,15H2,1-2H3,(H2,23,27) |
| InChIKey | RQKBXDKNENADND-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|