C16H24N2O4 — CID 145371946
[5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl pentanoate (PubChem CID 145371946) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl pentanoate.
| Compound Name | [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 145371946 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | [5-(3-carbamoyl-4H-pyridin-1-yl)oxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCC1CCC(N2C=CCC(C(N)=O)=C2)O1 |
| InChI | InChI=1S/C16H24N2O4/c1-2-3-6-15(19)21-11-13-7-8-14(22-13)18-9-4-5-12(10-18)16(17)20/h4,9-10,13-14H,2-3,5-8,11H2,1H3,(H2,17,20) |
| InChIKey | HXHIPZMUYQJZBI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |