C11H19IO3 — CID 118183523
[(2S,5S)-5-(iodomethyl)oxolan-2-yl]methyl pentanoate (PubChem CID 118183523) has the molecular formula C11H19IO3 and a molecular weight of 326.17 g/mol. Its IUPAC name is [(2S,5S)-5-(iodomethyl)oxolan-2-yl]methyl pentanoate.
| Compound Name | [(2S,5S)-5-(iodomethyl)oxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 118183523 |
| Molecular Formula | C11H19IO3 |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [(2S,5S)-5-(iodomethyl)oxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@@H]1CC[C@@H](CI)O1 |
| InChI | InChI=1S/C11H19IO3/c1-2-3-4-11(13)14-8-10-6-5-9(7-12)15-10/h9-10H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | NRBOVXIKWPFQME-UWVGGRQHSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|