C18H34O5 — CID 101106650
[6-(hydroxymethyl)-1,4-dioxan-2-yl]methyl dodecanoate (PubChem CID 101106650) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is [6-(hydroxymethyl)-1,4-dioxan-2-yl]methyl dodecanoate.
| Compound Name | [6-(hydroxymethyl)-1,4-dioxan-2-yl]methyl dodecanoate |
|---|---|
| PubChem CID | 101106650 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [6-(hydroxymethyl)-1,4-dioxan-2-yl]methyl dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCC1COCC(CO)O1 |
| InChI | InChI=1S/C18H34O5/c1-2-3-4-5-6-7-8-9-10-11-18(20)22-15-17-14-21-13-16(12-19)23-17/h16-17,19H,2-15H2,1H3 |
| InChIKey | IAUSSAKDSRAQKC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|