C10H18O4 — CID 118169205
[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]methyl butanoate (PubChem CID 118169205) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is [(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]methyl butanoate.
| Compound Name | [(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 118169205 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1CC[C@H](CO)O1 |
| InChI | InChI=1S/C10H18O4/c1-2-3-10(12)13-7-9-5-4-8(6-11)14-9/h8-9,11H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | WIVKMQRSDCYZDR-RKDXNWHRSA-N |
| XLogP | 0.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |