C19H26N2O8 — CID 159990842
4-O-[[(2S,3R,4R,5R)-4-acetyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-3-methyloxolan-2-yl]methyl] 1-O-methyl butanedioate (PubChem CID 159990842) has the molecular formula C19H26N2O8 and a molecular weight of 410.42 g/mol. Its IUPAC name is 4-O-[[(2S,3R,4R,5R)-4-acetyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-3-methyloxolan-2-yl]methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[(2S,3R,4R,5R)-4-acetyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-3-methyloxolan-2-yl]methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 159990842 |
| Molecular Formula | C19H26N2O8 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-O-[[(2S,3R,4R,5R)-4-acetyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-3-methyloxolan-2-yl]methyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OC[C@H]1O[C@@H](N2C=CCC(C(N)=O)=C2)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C19H26N2O8/c1-11-14(10-27-16(24)7-6-15(23)26-3)29-19(17(11)28-12(2)22)21-8-4-5-13(9-21)18(20)25/h4,8-9,11,14,17,19H,5-7,10H2,1-3H3,(H2,20,25)/t11-,14-,17-,19-/m1/s1 |
| InChIKey | MVVDQDPUXOODSK-MWKWTDJYSA-N |
| XLogP | 0.36 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|