C21H29NO8 — CID 174117184
[(2R,3R,4R,5R)-5-(3-acetyl-4H-pyridin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate (PubChem CID 174117184) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3-acetyl-4H-pyridin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(3-acetyl-4H-pyridin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 174117184 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3-acetyl-4H-pyridin-1-yl)-3,4-di(propanoyloxy)oxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OC[C@H]1O[C@@H](N2C=CCC(C(C)=O)=C2)[C@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C21H29NO8/c1-5-16(24)27-12-15-19(29-17(25)6-2)20(30-18(26)7-3)21(28-15)22-10-8-9-14(11-22)13(4)23/h8,10-11,15,19-21H,5-7,9,12H2,1-4H3/t15-,19-,20-,21-/m1/s1 |
| InChIKey | AYBAZJIBHHPLGY-NMSZZDKCSA-N |
| XLogP | 2.00 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|