C16H22N2O9 — CID 154954487
1-O-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-O-methyl (2S)-2-hydroxybutanedioate (PubChem CID 154954487) has the molecular formula C16H22N2O9 and a molecular weight of 386.36 g/mol. Its IUPAC name is 1-O-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-O-methyl (2S)-2-hydroxybutanedioate.
| Compound Name | 1-O-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-O-methyl (2S)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 154954487 |
| Molecular Formula | C16H22N2O9 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-O-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl] 4-O-methyl (2S)-2-hydroxybutanedioate |
| SMILES | COC(=O)C[C@H](O)C(=O)OC[C@H]1O[C@@H](N2C=CCC(C(N)=O)=C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H22N2O9/c1-25-11(20)5-9(19)16(24)26-7-10-12(21)13(22)15(27-10)18-4-2-3-8(6-18)14(17)23/h2,4,6,9-10,12-13,15,19,21-22H,3,5,7H2,1H3,(H2,17,23)/t9-,10+,12+,13+,15+/m0/s1 |
| InChIKey | RFVGAZHJDUAKQK-KHBBOIOASA-N |
| XLogP | -2.51 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |