C15H20N2O9 — CID 154954348
(3S)-4-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxy-4-oxobutanoic acid (PubChem CID 154954348) has the molecular formula C15H20N2O9 and a molecular weight of 372.33 g/mol. Its IUPAC name is (3S)-4-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxy-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 154954348 |
| Molecular Formula | C15H20N2O9 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (3S)-4-[[(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxy-4-oxobutanoic acid |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COC(=O)[C@@H](O)CC(=O)O)[C@@H](O)[C@H]2O)C=CC1 |
| InChI | InChI=1S/C15H20N2O9/c16-13(23)7-2-1-3-17(5-7)14-12(22)11(21)9(26-14)6-25-15(24)8(18)4-10(19)20/h1,3,5,8-9,11-12,14,18,21-22H,2,4,6H2,(H2,16,23)(H,19,20)/t8-,9+,11+,12+,14+/m0/s1 |
| InChIKey | NJJRGPCDVXVNDC-XKYXEJCGSA-N |
| XLogP | -2.60 |
| TPSA | 179.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |