C18H30N3O9P — CID 170106535
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid (PubChem CID 170106535) has the molecular formula C18H30N3O9P and a molecular weight of 463.42 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170106535 |
| Molecular Formula | C18H30N3O9P |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
| SMILES | COC(=O)[C@H](C)NP(=O)(NC(C)C)OC[C@H]1O[C@@H](N2C=CCC(C(=O)O)=C2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H30N3O9P/c1-10(2)19-31(27,20-11(3)18(26)28-4)29-9-13-14(22)15(23)16(30-13)21-7-5-6-12(8-21)17(24)25/h5,7-8,10-11,13-16,22-23H,6,9H2,1-4H3,(H,24,25)(H2,19,20,27)/t11-,13+,14+,15+,16+,31?/m0/s1 |
| InChIKey | JRTYJTKCCHPDCG-GWEQMCPXSA-N |
| XLogP | -0.11 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|