C23H36N3O11P — CID 155425541
1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxyethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid (PubChem CID 155425541) has the molecular formula C23H36N3O11P and a molecular weight of 561.53 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxyethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxyethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155425541 |
| Molecular Formula | C23H36N3O11P |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-(propan-2-ylamino)phosphoryl]oxyethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
| SMILES | COC(=O)[C@H](C)NP(=O)(NC(C)C)OCC[C@H]1O[C@@H](N2C=CCC(C(=O)O)=C2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H36N3O11P/c1-13(2)24-38(32,25-14(3)23(31)33-6)34-11-9-18-19(35-15(4)27)20(36-16(5)28)21(37-18)26-10-7-8-17(12-26)22(29)30/h7,10,12-14,18-21H,8-9,11H2,1-6H3,(H,29,30)(H2,24,25,32)/t14-,18+,19+,20+,21+,38?/m0/s1 |
| InChIKey | RQEATPUGRDCNNU-WLJYMARPSA-N |
| XLogP | 1.43 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|