C20H28N2O9 — CID 154954250
1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid (PubChem CID 154954250) has the molecular formula C20H28N2O9 and a molecular weight of 440.45 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 154954250 |
| Molecular Formula | C20H28N2O9 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[[(2S)-2-amino-3-methylbutanoyl]oxymethyl]oxolan-2-yl]-4H-pyridine-3-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](COC(=O)[C@@H](N)C(C)C)O[C@H]1N1C=CCC(C(=O)O)=C1 |
| InChI | InChI=1S/C20H28N2O9/c1-10(2)15(21)20(27)28-9-14-16(29-11(3)23)17(30-12(4)24)18(31-14)22-7-5-6-13(8-22)19(25)26/h5,7-8,10,14-18H,6,9,21H2,1-4H3,(H,25,26)/t14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | RVQWURCURBEOJB-CWQOZTLDSA-N |
| XLogP | 0.29 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|