C21H28N3O8P — CID 145307280
methyl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 145307280) has the molecular formula C21H28N3O8P and a molecular weight of 481.44 g/mol. Its IUPAC name is methyl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | methyl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 145307280 |
| Molecular Formula | C21H28N3O8P |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | methyl 2-[[[5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(OCC1OC(N2C=CCC(C(N)=O)=C2)C(O)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C21H28N3O8P/c1-13(21(28)29-2)23-33(32-15-8-4-3-5-9-15)30-12-16-17(25)18(26)20(31-16)24-10-6-7-14(11-24)19(22)27/h3-6,8-11,13,16-18,20,23,25-26H,7,12H2,1-2H3,(H2,22,27) |
| InChIKey | XELYBXRTHSJXGP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|