C24H38NO6P — CID 169242668
1-cyclohexylethyl (2S)-2-[[[(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 169242668) has the molecular formula C24H38NO6P and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-cyclohexylethyl (2S)-2-[[[(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | 1-cyclohexylethyl (2S)-2-[[[(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 169242668 |
| Molecular Formula | C24H38NO6P |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-cyclohexylethyl (2S)-2-[[[(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | CC(OC(=O)[C@H](C)NP(OC[C@H]1O[C@@H](C)[C@H](C)[C@@H]1O)Oc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H38NO6P/c1-16-18(3)29-22(23(16)26)15-28-32(31-21-13-9-6-10-14-21)25-17(2)24(27)30-19(4)20-11-7-5-8-12-20/h6,9-10,13-14,16-20,22-23,25-26H,5,7-8,11-12,15H2,1-4H3/t16-,17-,18-,19?,22+,23-,32?/m0/s1 |
| InChIKey | IBRYJHYVIQPMNS-FBYVWCPSSA-N |
| XLogP | 4.58 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|