C26H40N3O9P — CID 169242670
3-ethylpentan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[methyl(prop-2-enoylcarbamoyl)amino]oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 169242670) has the molecular formula C26H40N3O9P and a molecular weight of 569.59 g/mol. Its IUPAC name is 3-ethylpentan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[methyl(prop-2-enoylcarbamoyl)amino]oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | 3-ethylpentan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[methyl(prop-2-enoylcarbamoyl)amino]oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 169242670 |
| Molecular Formula | C26H40N3O9P |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 3-ethylpentan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[methyl(prop-2-enoylcarbamoyl)amino]oxolan-2-yl]methoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | C=CC(=O)NC(=O)N(C)[C@@H]1O[C@H](COP(N[C@@H](C)C(=O)OC(C)C(CC)CC)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H40N3O9P/c1-7-18(8-2)17(5)36-25(33)16(4)28-39(38-19-13-11-10-12-14-19)35-15-20-22(31)23(32)24(37-20)29(6)26(34)27-21(30)9-3/h9-14,16-18,20,22-24,28,31-32H,3,7-8,15H2,1-2,4-6H3,(H,27,30,34)/t16-,17?,20+,22+,23+,24+,39?/m0/s1 |
| InChIKey | SPRMZCIPOPMONK-NKHWMCLWSA-N |
| XLogP | 2.46 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|