C27H37N2O6P — CID 130280986
1-phenylethyl 2-[[[2-methoxy-4-[methyl-[(Z)-3-oxoprop-1-enyl]amino]pentoxy]-phenoxyphosphanyl]amino]propanoate (PubChem CID 130280986) has the molecular formula C27H37N2O6P and a molecular weight of 516.58 g/mol. Its IUPAC name is 1-phenylethyl 2-[[[2-methoxy-4-[methyl-[(Z)-3-oxoprop-1-enyl]amino]pentoxy]-phenoxyphosphanyl]amino]propanoate.
| Compound Name | 1-phenylethyl 2-[[[2-methoxy-4-[methyl-[(Z)-3-oxoprop-1-enyl]amino]pentoxy]-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 130280986 |
| Molecular Formula | C27H37N2O6P |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 1-phenylethyl 2-[[[2-methoxy-4-[methyl-[(Z)-3-oxoprop-1-enyl]amino]pentoxy]-phenoxyphosphanyl]amino]propanoate |
| SMILES | COC(COP(NC(C)C(=O)OC(C)c1ccccc1)Oc1ccccc1)CC(C)N(C)/C=C\C=O |
| InChI | InChI=1S/C27H37N2O6P/c1-21(29(4)17-12-18-30)19-26(32-5)20-33-36(35-25-15-10-7-11-16-25)28-22(2)27(31)34-23(3)24-13-8-6-9-14-24/h6-18,21-23,26,28H,19-20H2,1-5H3/b17-12- |
| InChIKey | DUUKSWJMFWKWSU-ATVHPVEESA-N |
| XLogP | 5.03 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|