C23H33N6O6P — CID 144985309
methyl 2-[[2-[1-(2-amino-6-ethoxypurin-9-yl)ethoxy]butoxy-phenoxyphosphanyl]amino]propanoate (PubChem CID 144985309) has the molecular formula C23H33N6O6P and a molecular weight of 520.53 g/mol. Its IUPAC name is methyl 2-[[2-[1-(2-amino-6-ethoxypurin-9-yl)ethoxy]butoxy-phenoxyphosphanyl]amino]propanoate.
| Compound Name | methyl 2-[[2-[1-(2-amino-6-ethoxypurin-9-yl)ethoxy]butoxy-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 144985309 |
| Molecular Formula | C23H33N6O6P |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | methyl 2-[[2-[1-(2-amino-6-ethoxypurin-9-yl)ethoxy]butoxy-phenoxyphosphanyl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2C(C)OC(CC)COP(NC(C)C(=O)OC)Oc1ccccc1 |
| InChI | InChI=1S/C23H33N6O6P/c1-6-17(13-33-36(28-15(3)22(30)31-5)35-18-11-9-8-10-12-18)34-16(4)29-14-25-19-20(29)26-23(24)27-21(19)32-7-2/h8-12,14-17,28H,6-7,13H2,1-5H3,(H2,24,26,27) |
| InChIKey | MALAKADGKBOIBR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|