C33H30ClN5O7 — CID 88893560
[(2R)-2-[1-(2-amino-6-chloropurin-9-yl)ethoxy]-3,4-dibenzoyloxypentyl] benzoate (PubChem CID 88893560) has the molecular formula C33H30ClN5O7 and a molecular weight of 644.08 g/mol. Its IUPAC name is [(2R)-2-[1-(2-amino-6-chloropurin-9-yl)ethoxy]-3,4-dibenzoyloxypentyl] benzoate.
| Compound Name | [(2R)-2-[1-(2-amino-6-chloropurin-9-yl)ethoxy]-3,4-dibenzoyloxypentyl] benzoate |
|---|---|
| PubChem CID | 88893560 |
| Molecular Formula | C33H30ClN5O7 |
| Molecular Weight | 644.08 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | [(2R)-2-[1-(2-amino-6-chloropurin-9-yl)ethoxy]-3,4-dibenzoyloxypentyl] benzoate |
| SMILES | CC(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OC(C)n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C33H30ClN5O7/c1-20(44-31(41)23-14-8-4-9-15-23)27(46-32(42)24-16-10-5-11-17-24)25(18-43-30(40)22-12-6-3-7-13-22)45-21(2)39-19-36-26-28(34)37-33(35)38-29(26)39/h3-17,19-21,25,27H,18H2,1-2H3,(H2,35,37,38)/t20?,21?,25-,27?/m1/s1 |
| InChIKey | HZZUQKFTFRCQEH-FPAKMXNWSA-N |
| XLogP | 5.29 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.08 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|