C24H21ClFN5O5 — CID 90346824
[(2R,4S)-5-(6-amino-2-chloropurin-9-yl)-3-benzoyloxy-4-fluoro-2-hydroxypentyl] benzoate (PubChem CID 90346824) has the molecular formula C24H21ClFN5O5 and a molecular weight of 513.91 g/mol. Its IUPAC name is [(2R,4S)-5-(6-amino-2-chloropurin-9-yl)-3-benzoyloxy-4-fluoro-2-hydroxypentyl] benzoate.
| Compound Name | [(2R,4S)-5-(6-amino-2-chloropurin-9-yl)-3-benzoyloxy-4-fluoro-2-hydroxypentyl] benzoate |
|---|---|
| PubChem CID | 90346824 |
| Molecular Formula | C24H21ClFN5O5 |
| Molecular Weight | 513.91 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | [(2R,4S)-5-(6-amino-2-chloropurin-9-yl)-3-benzoyloxy-4-fluoro-2-hydroxypentyl] benzoate |
| SMILES | Nc1nc(Cl)nc2c1ncn2C[C@H](F)C(OC(=O)c1ccccc1)[C@H](O)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21ClFN5O5/c25-24-29-20(27)18-21(30-24)31(13-28-18)11-16(26)19(36-23(34)15-9-5-2-6-10-15)17(32)12-35-22(33)14-7-3-1-4-8-14/h1-10,13,16-17,19,32H,11-12H2,(H2,27,29,30)/t16-,17+,19?/m0/s1 |
| InChIKey | RCTBNQIUJHLYTB-PZEDNMLSSA-N |
| XLogP | 2.84 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |