C25H24ClN5O5 — CID 88559442
[(2R)-2-[1-(6-amino-2-chloropurin-9-yl)ethoxy]-3-benzoyloxybutyl] benzoate (PubChem CID 88559442) has the molecular formula C25H24ClN5O5 and a molecular weight of 509.95 g/mol. Its IUPAC name is [(2R)-2-[1-(6-amino-2-chloropurin-9-yl)ethoxy]-3-benzoyloxybutyl] benzoate.
| Compound Name | [(2R)-2-[1-(6-amino-2-chloropurin-9-yl)ethoxy]-3-benzoyloxybutyl] benzoate |
|---|---|
| PubChem CID | 88559442 |
| Molecular Formula | C25H24ClN5O5 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [(2R)-2-[1-(6-amino-2-chloropurin-9-yl)ethoxy]-3-benzoyloxybutyl] benzoate |
| SMILES | CC(OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OC(C)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C25H24ClN5O5/c1-15(35-24(33)18-11-7-4-8-12-18)19(13-34-23(32)17-9-5-3-6-10-17)36-16(2)31-14-28-20-21(27)29-25(26)30-22(20)31/h3-12,14-16,19H,13H2,1-2H3,(H2,27,29,30)/t15?,16?,19-/m1/s1 |
| InChIKey | YQPRDECEYSOTDB-LADRWXRNSA-N |
| XLogP | 4.07 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |