C15H12Cl4N6O2 — CID 175058256
[1-(6-amino-2-chloropurin-9-yl)-2,2,2-trichloroethyl]-benzylcarbamic acid (PubChem CID 175058256) has the molecular formula C15H12Cl4N6O2 and a molecular weight of 450.11 g/mol. Its IUPAC name is [1-(6-amino-2-chloropurin-9-yl)-2,2,2-trichloroethyl]-benzylcarbamic acid.
| Compound Name | [1-(6-amino-2-chloropurin-9-yl)-2,2,2-trichloroethyl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 175058256 |
| Molecular Formula | C15H12Cl4N6O2 |
| Molecular Weight | 450.11 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | [1-(6-amino-2-chloropurin-9-yl)-2,2,2-trichloroethyl]-benzylcarbamic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2C(N(Cc1ccccc1)C(=O)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H12Cl4N6O2/c16-13-22-10(20)9-11(23-13)25(7-21-9)12(15(17,18)19)24(14(26)27)6-8-4-2-1-3-5-8/h1-5,7,12H,6H2,(H,26,27)(H2,20,22,23) |
| InChIKey | IMFRSFPRKBWKHI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|