C13H15ClFN5O7 — CID 166843793
2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid (PubChem CID 166843793) has the molecular formula C13H15ClFN5O7 and a molecular weight of 407.74 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid.
| Compound Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid |
|---|---|
| PubChem CID | 166843793 |
| Molecular Formula | C13H15ClFN5O7 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]propanedioic acid |
| SMILES | CO[C@H](COC(C(=O)O)C(=O)O)[C@@H](O)[C@H](F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C13H15ClFN5O7/c1-26-4(2-27-7(11(22)23)12(24)25)6(21)8(15)20-3-17-5-9(16)18-13(14)19-10(5)20/h3-4,6-8,21H,2H2,1H3,(H,22,23)(H,24,25)(H2,16,18,19)/t4-,6-,8-/m1/s1 |
| InChIKey | IFSCKMDKCOEAIK-UEYSZJFGSA-N |
| XLogP | -0.54 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|