C21H20ClFN6O6 — CID 142388937
2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(4-cyanophenyl)methyl]propanedioic acid (PubChem CID 142388937) has the molecular formula C21H20ClFN6O6 and a molecular weight of 506.88 g/mol. Its IUPAC name is 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(4-cyanophenyl)methyl]propanedioic acid.
| Compound Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(4-cyanophenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 142388937 |
| Molecular Formula | C21H20ClFN6O6 |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(4-cyanophenyl)methyl]propanedioic acid |
| SMILES | COC(COC(Cc1ccc(C#N)cc1)(C(=O)O)C(=O)O)CC(F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C21H20ClFN6O6/c1-34-13(6-14(23)29-10-26-15-16(25)27-20(22)28-17(15)29)9-35-21(18(30)31,19(32)33)7-11-2-4-12(8-24)5-3-11/h2-5,10,13-14H,6-7,9H2,1H3,(H,30,31)(H,32,33)(H2,25,27,28) |
| InChIKey | KTGNWUHVBJEXGK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 186.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|