C19H19ClFN5O8S — CID 134336164
2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(5-carboxythiophen-3-yl)methyl]propanedioic acid (PubChem CID 134336164) has the molecular formula C19H19ClFN5O8S and a molecular weight of 531.91 g/mol. Its IUPAC name is 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(5-carboxythiophen-3-yl)methyl]propanedioic acid.
| Compound Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(5-carboxythiophen-3-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 134336164 |
| Molecular Formula | C19H19ClFN5O8S |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | 2-[4-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-methoxybutoxy]-2-[(5-carboxythiophen-3-yl)methyl]propanedioic acid |
| SMILES | COC(COC(Cc1csc(C(=O)O)c1)(C(=O)O)C(=O)O)CC(F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C19H19ClFN5O8S/c1-33-9(3-11(21)26-7-23-12-13(22)24-18(20)25-14(12)26)5-34-19(16(29)30,17(31)32)4-8-2-10(15(27)28)35-6-8/h2,6-7,9,11H,3-5H2,1H3,(H,27,28)(H,29,30)(H,31,32)(H2,22,24,25) |
| InChIKey | VXMPCMJHQRPLLO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|