C15H17ClFN9O7 — CID 166843800
2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(2H-tetrazol-5-ylmethyl)propanedioic acid (PubChem CID 166843800) has the molecular formula C15H17ClFN9O7 and a molecular weight of 489.81 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(2H-tetrazol-5-ylmethyl)propanedioic acid.
| Compound Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(2H-tetrazol-5-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 166843800 |
| Molecular Formula | C15H17ClFN9O7 |
| Molecular Weight | 489.81 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[(2R,3R,4S)-4-(6-amino-2-chloropurin-9-yl)-4-fluoro-3-hydroxy-2-methoxybutoxy]-2-(2H-tetrazol-5-ylmethyl)propanedioic acid |
| SMILES | CO[C@H](COC(Cc1nn[nH]n1)(C(=O)O)C(=O)O)[C@@H](O)[C@H](F)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C15H17ClFN9O7/c1-32-5(3-33-15(12(28)29,13(30)31)2-6-22-24-25-23-6)8(27)9(17)26-4-19-7-10(18)20-14(16)21-11(7)26/h4-5,8-9,27H,2-3H2,1H3,(H,28,29)(H,30,31)(H2,18,20,21)(H,22,23,24,25)/t5-,8-,9-/m1/s1 |
| InChIKey | DWPADGKQPBBJIZ-JISRMSBWSA-N |
| XLogP | -1.41 |
| TPSA | 237.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.81 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|