C21H22ClN5O9 — CID 135197379
2-[(2S,4R)-4-(6-amino-2-chloropurin-9-yl)-4-hydroxy-2-methoxybutoxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid (PubChem CID 135197379) has the molecular formula C21H22ClN5O9 and a molecular weight of 523.89 g/mol. Its IUPAC name is 2-[(2S,4R)-4-(6-amino-2-chloropurin-9-yl)-4-hydroxy-2-methoxybutoxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid.
| Compound Name | 2-[(2S,4R)-4-(6-amino-2-chloropurin-9-yl)-4-hydroxy-2-methoxybutoxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 135197379 |
| Molecular Formula | C21H22ClN5O9 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 2-[(2S,4R)-4-(6-amino-2-chloropurin-9-yl)-4-hydroxy-2-methoxybutoxy]-2-[(4-carboxyphenyl)methyl]propanedioic acid |
| SMILES | CO[C@H](COC(Cc1ccc(C(=O)O)cc1)(C(=O)O)C(=O)O)C[C@@H](O)n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C21H22ClN5O9/c1-35-12(6-13(28)27-9-24-14-15(23)25-20(22)26-16(14)27)8-36-21(18(31)32,19(33)34)7-10-2-4-11(5-3-10)17(29)30/h2-5,9,12-13,28H,6-8H2,1H3,(H,29,30)(H,31,32)(H,33,34)(H2,23,25,26)/t12-,13+/m0/s1 |
| InChIKey | TUDJGJTZYCLSEV-QWHCGFSZSA-N |
| XLogP | 0.82 |
| TPSA | 220.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|