C29H38ClFN4O6S — CID 135182326
diethyl 2-benzyl-2-[4-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-2-methoxybutoxy]propanedioate (PubChem CID 135182326) has the molecular formula C29H38ClFN4O6S and a molecular weight of 625.16 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[4-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-2-methoxybutoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[4-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-2-methoxybutoxy]propanedioate |
|---|---|
| PubChem CID | 135182326 |
| Molecular Formula | C29H38ClFN4O6S |
| Molecular Weight | 625.16 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | diethyl 2-benzyl-2-[4-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-2-methoxybutoxy]propanedioate |
| SMILES | CCCCCSc1nc(Cl)nc2c1ncn2C(F)CC(COC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC)OC |
| InChI | InChI=1S/C29H38ClFN4O6S/c1-5-8-12-15-42-25-23-24(33-28(30)34-25)35(19-32-23)22(31)16-21(38-4)18-41-29(26(36)39-6-2,27(37)40-7-3)17-20-13-10-9-11-14-20/h9-11,13-14,19,21-22H,5-8,12,15-18H2,1-4H3 |
| InChIKey | SVPJPUZUTKXBNB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.16 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|