C27H30ClFN4O7S — CID 148630069
2-benzyl-2-[[(1R,3R,4S,5R)-3-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-3-ethoxy-3-oxopropanoic acid (PubChem CID 148630069) has the molecular formula C27H30ClFN4O7S and a molecular weight of 609.08 g/mol. Its IUPAC name is 2-benzyl-2-[[(1R,3R,4S,5R)-3-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-3-ethoxy-3-oxopropanoic acid.
| Compound Name | 2-benzyl-2-[[(1R,3R,4S,5R)-3-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-3-ethoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 148630069 |
| Molecular Formula | C27H30ClFN4O7S |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 2-benzyl-2-[[(1R,3R,4S,5R)-3-(2-chloro-6-pentylsulfanylpurin-9-yl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy]-3-ethoxy-3-oxopropanoic acid |
| SMILES | CCCCCSc1nc(Cl)nc2c1ncn2[C@@H]1O[C@@H]2C(OC(Cc3ccccc3)(C(=O)O)C(=O)OCC)[C@]2(O)[C@@H]1F |
| InChI | InChI=1S/C27H30ClFN4O7S/c1-3-5-9-12-41-21-16-20(31-25(28)32-21)33(14-30-16)22-17(29)27(37)18(39-22)19(27)40-26(23(34)35,24(36)38-4-2)13-15-10-7-6-8-11-15/h6-8,10-11,14,17-19,22,37H,3-5,9,12-13H2,1-2H3,(H,34,35)/t17-,18-,19?,22-,26?,27+/m1/s1 |
| InChIKey | NHYYQHJNCWUAGK-KRXPWZMPSA-N |
| XLogP | 3.76 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|