C32H45ClN4O7Si — CID 174031862
diethyl 2-benzyl-2-[[(2S,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloro-6-methylpurin-9-yl)-3-methyloxolan-2-yl]methoxy]propanedioate (PubChem CID 174031862) has the molecular formula C32H45ClN4O7Si and a molecular weight of 661.27 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[[(2S,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloro-6-methylpurin-9-yl)-3-methyloxolan-2-yl]methoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[[(2S,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloro-6-methylpurin-9-yl)-3-methyloxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 174031862 |
| Molecular Formula | C32H45ClN4O7Si |
| Molecular Weight | 661.27 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | diethyl 2-benzyl-2-[[(2S,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-chloro-6-methylpurin-9-yl)-3-methyloxolan-2-yl]methoxy]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC[C@H]1O[C@@H](n2cnc3c(C)nc(Cl)nc32)C(O[Si](C)(C)C(C)(C)C)[C@@H]1C)C(=O)OCC |
| InChI | InChI=1S/C32H45ClN4O7Si/c1-10-40-28(38)32(29(39)41-11-2,17-22-15-13-12-14-16-22)42-18-23-20(3)25(44-45(8,9)31(5,6)7)27(43-23)37-19-34-24-21(4)35-30(33)36-26(24)37/h12-16,19-20,23,25,27H,10-11,17-18H2,1-9H3/t20-,23-,25?,27-/m1/s1 |
| InChIKey | VHMJLMXVFMEXCW-ONHMRBRKSA-N |
| XLogP | 5.84 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.27 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|