C17H28ClN5O3Si — CID 167580905
(2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyloxolan-3-ol (PubChem CID 167580905) has the molecular formula C17H28ClN5O3Si and a molecular weight of 413.98 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyloxolan-3-ol |
|---|---|
| PubChem CID | 167580905 |
| Molecular Formula | C17H28ClN5O3Si |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyloxolan-3-ol |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C17H28ClN5O3Si/c1-7-9-11(24)12(26-27(5,6)17(2,3)4)15(25-9)23-8-20-10-13(19)21-16(18)22-14(10)23/h8-9,11-12,15,24H,7H2,1-6H3,(H2,19,21,22)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | UMGZHAIVHNWMGZ-SDBHATRESA-N |
| XLogP | 3.12 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|