C22H40ClN5O3SSi2 — CID 11731295
[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]thiolan-2-yl]methanol (PubChem CID 11731295) has the molecular formula C22H40ClN5O3SSi2 and a molecular weight of 546.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]thiolan-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]thiolan-2-yl]methanol |
|---|---|
| PubChem CID | 11731295 |
| Molecular Formula | C22H40ClN5O3SSi2 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]thiolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)S[C@H]1n1cnc2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C22H40ClN5O3SSi2/c1-21(2,3)33(7,8)30-15-13(11-29)32-19(16(15)31-34(9,10)22(4,5)6)28-12-25-14-17(24)26-20(23)27-18(14)28/h12-13,15-16,19,29H,11H2,1-10H3,(H2,24,26,27)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | AELJHCFAQYDOIU-NVQRDWNXSA-N |
| XLogP | 5.45 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|