C9H10ClN5O3 — CID 21145907
[4-(6-amino-2-chloropurin-9-yl)-1,3-dioxolan-2-yl]methanol (PubChem CID 21145907) has the molecular formula C9H10ClN5O3 and a molecular weight of 271.66 g/mol. Its IUPAC name is [4-(6-amino-2-chloropurin-9-yl)-1,3-dioxolan-2-yl]methanol.
| Compound Name | [4-(6-amino-2-chloropurin-9-yl)-1,3-dioxolan-2-yl]methanol |
|---|---|
| PubChem CID | 21145907 |
| Molecular Formula | C9H10ClN5O3 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [4-(6-amino-2-chloropurin-9-yl)-1,3-dioxolan-2-yl]methanol |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1COC(CO)O1 |
| InChI | InChI=1S/C9H10ClN5O3/c10-9-13-7(11)6-8(14-9)15(3-12-6)4-2-17-5(1-16)18-4/h3-5,16H,1-2H2,(H2,11,13,14) |
| InChIKey | PIGAIMDIRINNKI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |