C11H14N6O4 — CID 118700032
[(2R)-4-(2,6-diaminopurin-9-yl)-1,3-dioxolan-2-yl]methyl acetate (PubChem CID 118700032) has the molecular formula C11H14N6O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is [(2R)-4-(2,6-diaminopurin-9-yl)-1,3-dioxolan-2-yl]methyl acetate.
| Compound Name | [(2R)-4-(2,6-diaminopurin-9-yl)-1,3-dioxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118700032 |
| Molecular Formula | C11H14N6O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [(2R)-4-(2,6-diaminopurin-9-yl)-1,3-dioxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OCC(n2cnc3c(N)nc(N)nc32)O1 |
| InChI | InChI=1S/C11H14N6O4/c1-5(18)19-3-7-20-2-6(21-7)17-4-14-8-9(12)15-11(13)16-10(8)17/h4,6-7H,2-3H2,1H3,(H4,12,13,15,16)/t6?,7-/m1/s1 |
| InChIKey | ZAJBAIIRIUOHJT-COBSHVIPSA-N |
| XLogP | -0.57 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |