C20H24N7O7P — CID 66741662
CID 66741662 (PubChem CID 66741662) has the molecular formula C20H24N7O7P and a molecular weight of 505.43 g/mol.
| Compound Name | CID 66741662 |
|---|---|
| PubChem CID | 66741662 |
| Molecular Formula | C20H24N7O7P |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | — |
| SMILES | CC[C@@](C)(/N=[P+](\[O-])Oc1ccccc1OCC1OC[C@H](n2cnc3c(N)nc(N)nc32)O1)C(=O)O |
| InChI | InChI=1S/C20H24N7O7P/c1-3-20(2,18(28)29)26-35(30)34-12-7-5-4-6-11(12)31-9-14-32-8-13(33-14)27-10-23-15-16(21)24-19(22)25-17(15)27/h4-7,10,13-14H,3,8-9H2,1-2H3,(H,28,29)(H4,21,22,24,25)/t13-,14?,20-/m1/s1 |
| InChIKey | HCWXTNSJSRXOJI-GVZCWWSKSA-N |
| XLogP | 1.43 |
| TPSA | 205.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|