C25H26ClFN4O3Si — CID 54310455
tert-butyl-[[4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methoxy]-diphenylsilane (PubChem CID 54310455) has the molecular formula C25H26ClFN4O3Si and a molecular weight of 513.05 g/mol. Its IUPAC name is tert-butyl-[[4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 54310455 |
| Molecular Formula | C25H26ClFN4O3Si |
| Molecular Weight | 513.05 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | tert-butyl-[[4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1OCC(n2cnc3c(Cl)nc(F)nc32)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26ClFN4O3Si/c1-25(2,3)35(17-10-6-4-7-11-17,18-12-8-5-9-13-18)33-15-20-32-14-19(34-20)31-16-28-21-22(26)29-24(27)30-23(21)31/h4-13,16,19-20H,14-15H2,1-3H3 |
| InChIKey | SKMQPSUIEXHKRF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|