C29H33ClN4O3SeSi — CID 102103458
[(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 102103458) has the molecular formula C29H33ClN4O3SeSi and a molecular weight of 628.11 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102103458 |
| Molecular Formula | C29H33ClN4O3SeSi |
| Molecular Weight | 628.11 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | [(3aR,4R,6R,6aS)-4-(6-chloropurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[Se][C@H]2n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C29H33ClN4O3SeSi/c1-28(2,3)39(19-12-8-6-9-13-19,20-14-10-7-11-15-20)35-16-21-23-24(37-29(4,5)36-23)27(38-21)34-18-33-22-25(30)31-17-32-26(22)34/h6-15,17-18,21,23-24,27H,16H2,1-5H3/t21-,23-,24-,27-/m1/s1 |
| InChIKey | MWIFQRWBMOQKSC-VBHAUSMQSA-N |
| XLogP | 4.58 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.11 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|