C27H31ClN4O2Si — CID 134835032
tert-butyl-[2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethoxy]-diphenylsilane (PubChem CID 134835032) has the molecular formula C27H31ClN4O2Si and a molecular weight of 507.11 g/mol. Its IUPAC name is tert-butyl-[2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134835032 |
| Molecular Formula | C27H31ClN4O2Si |
| Molecular Weight | 507.11 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | tert-butyl-[2-[(2S,3R)-3-(6-chloropurin-9-yl)oxolan-2-yl]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1OCC[C@H]1n1cnc2c(Cl)ncnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31ClN4O2Si/c1-27(2,3)35(20-10-6-4-7-11-20,21-12-8-5-9-13-21)34-17-15-23-22(14-16-33-23)32-19-31-24-25(28)29-18-30-26(24)32/h4-13,18-19,22-23H,14-17H2,1-3H3/t22-,23+/m1/s1 |
| InChIKey | JNHAQCMBZUJYCO-PKTZIBPZSA-N |
| XLogP | 4.78 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.11 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|