C26H29ClN4O3Si — CID 174055921
3-[9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-chloropurin-8-yl]propanoic acid (PubChem CID 174055921) has the molecular formula C26H29ClN4O3Si and a molecular weight of 509.08 g/mol. Its IUPAC name is 3-[9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-chloropurin-8-yl]propanoic acid.
| Compound Name | 3-[9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-chloropurin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 174055921 |
| Molecular Formula | C26H29ClN4O3Si |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 3-[9-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-chloropurin-8-yl]propanoic acid |
| SMILES | CC(C)(C)[Si](OCCn1c(CCC(=O)O)nc2c(Cl)ncnc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN4O3Si/c1-26(2,3)35(19-10-6-4-7-11-19,20-12-8-5-9-13-20)34-17-16-31-21(14-15-22(32)33)30-23-24(27)28-18-29-25(23)31/h4-13,18H,14-17H2,1-3H3,(H,32,33) |
| InChIKey | GXWPWAJTHIFWSO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|