C21H29ClN4O2Si — CID 151919127
tert-butyl-[2-[6-chloro-8-(phenylmethoxymethyl)purin-9-yl]ethoxy]-dimethylsilane (PubChem CID 151919127) has the molecular formula C21H29ClN4O2Si and a molecular weight of 433.03 g/mol. Its IUPAC name is tert-butyl-[2-[6-chloro-8-(phenylmethoxymethyl)purin-9-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[6-chloro-8-(phenylmethoxymethyl)purin-9-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 151919127 |
| Molecular Formula | C21H29ClN4O2Si |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | tert-butyl-[2-[6-chloro-8-(phenylmethoxymethyl)purin-9-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1c(COCc2ccccc2)nc2c(Cl)ncnc21 |
| InChI | InChI=1S/C21H29ClN4O2Si/c1-21(2,3)29(4,5)28-12-11-26-17(14-27-13-16-9-7-6-8-10-16)25-18-19(22)23-15-24-20(18)26/h6-10,15H,11-14H2,1-5H3 |
| InChIKey | SWKAMNBOQCCSJF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|