C22H23ClN4O3 — CID 10550395
6-chloro-9-[(1S,2R,4S,5R,6R)-8,8-dimethyl-5-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]purine (PubChem CID 10550395) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is 6-chloro-9-[(1S,2R,4S,5R,6R)-8,8-dimethyl-5-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]purine.
| Compound Name | 6-chloro-9-[(1S,2R,4S,5R,6R)-8,8-dimethyl-5-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]purine |
|---|---|
| PubChem CID | 10550395 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 6-chloro-9-[(1S,2R,4S,5R,6R)-8,8-dimethyl-5-(phenylmethoxymethyl)-7,9-dioxatricyclo[4.3.0.02,4]nonan-2-yl]purine |
| SMILES | CC1(C)O[C@@H]2[C@@H](COCc3ccccc3)[C@@H]3C[C@]3(n3cnc4c(Cl)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C22H23ClN4O3/c1-21(2)29-17-14(10-28-9-13-6-4-3-5-7-13)15-8-22(15,18(17)30-21)27-12-26-16-19(23)24-11-25-20(16)27/h3-7,11-12,14-15,17-18H,8-10H2,1-2H3/t14-,15-,17+,18+,22+/m0/s1 |
| InChIKey | CUPDZEHGLJYORT-BOLKEHNOSA-N |
| XLogP | 3.56 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |