C30H33N5O4 — CID 11092634
9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine (PubChem CID 11092634) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
|---|---|
| PubChem CID | 11092634 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-4-methyl-2-phenyl-6-(phenylmethoxymethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]-N-cyclopentylpurin-6-amine |
| SMILES | C[C@@]1(n2cnc3c(NC4CCCC4)ncnc32)O[C@H](COCc2ccccc2)[C@H]2OC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C30H33N5O4/c1-30(35-19-33-24-27(31-18-32-28(24)35)34-22-14-8-9-15-22)26-25(37-29(38-26)21-12-6-3-7-13-21)23(39-30)17-36-16-20-10-4-2-5-11-20/h2-7,10-13,18-19,22-23,25-26,29H,8-9,14-17H2,1H3,(H,31,32,34)/t23-,25-,26-,29?,30-/m1/s1 |
| InChIKey | IMULFFSAGDAPHY-PAALVHEWSA-N |
| XLogP | 4.95 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |